C7H13Cl2F3O3 — CID 22359614
2-(1,2-dichloropropoxy)ethanol;2,2,2-trifluoroethanol (PubChem CID 22359614) has the molecular formula C7H13Cl2F3O3 and a molecular weight of 273.08 g/mol. Its IUPAC name is 2-(1,2-dichloropropoxy)ethanol;2,2,2-trifluoroethanol.
| Compound Name | 2-(1,2-dichloropropoxy)ethanol;2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 22359614 |
| Molecular Formula | C7H13Cl2F3O3 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-(1,2-dichloropropoxy)ethanol;2,2,2-trifluoroethanol |
| SMILES | CC(Cl)C(Cl)OCCO.OCC(F)(F)F |
| InChI | InChI=1S/C5H10Cl2O2.C2H3F3O/c1-4(6)5(7)9-3-2-8;3-2(4,5)1-6/h4-5,8H,2-3H2,1H3;6H,1H2 |
| InChIKey | VYQIEBVGUQECPJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|