C18H28ClN2O3+ — CID 22361889
2-(1,3,5-trimethylpiperidin-1-ium-1-yl)ethyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 22361889) has the molecular formula C18H28ClN2O3+ and a molecular weight of 355.89 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpiperidin-1-ium-1-yl)ethyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | 2-(1,3,5-trimethylpiperidin-1-ium-1-yl)ethyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 22361889 |
| Molecular Formula | C18H28ClN2O3+ |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-(1,3,5-trimethylpiperidin-1-ium-1-yl)ethyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC[N+]1(C)CC(C)CC(C)C1 |
| InChI | InChI=1S/C18H27ClN2O3/c1-12-7-13(2)11-21(3,10-12)5-6-24-18(22)14-8-15(19)16(20)9-17(14)23-4/h8-9,12-13H,5-7,10-11H2,1-4H3,(H-,20,22)/p+1 |
| InChIKey | NUMNEMGGPFROBE-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|