C22H27ClN2O4 — CID 2236777
N-[4-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-2-methoxyphenyl]pentanamide (PubChem CID 2236777) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is N-[4-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-2-methoxyphenyl]pentanamide.
| Compound Name | N-[4-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-2-methoxyphenyl]pentanamide |
|---|---|
| PubChem CID | 2236777 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[4-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-2-methoxyphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=O)C(C)(C)Oc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C22H27ClN2O4/c1-5-6-7-20(26)25-18-13-10-16(14-19(18)28-4)24-21(27)22(2,3)29-17-11-8-15(23)9-12-17/h8-14H,5-7H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | HRMPAJOOXIFNKJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |