C13H7F2N3O4 — CID 22369317
5-amino-6,7-difluoro-1-(1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 22369317) has the molecular formula C13H7F2N3O4 and a molecular weight of 307.21 g/mol. Its IUPAC name is 5-amino-6,7-difluoro-1-(1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-6,7-difluoro-1-(1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22369317 |
| Molecular Formula | C13H7F2N3O4 |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5-amino-6,7-difluoro-1-(1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1c(F)c(F)cc2c1c(=O)c(C(=O)O)cn2-c1ccon1 |
| InChI | InChI=1S/C13H7F2N3O4/c14-6-3-7-9(11(16)10(6)15)12(19)5(13(20)21)4-18(7)8-1-2-22-17-8/h1-4H,16H2,(H,20,21) |
| InChIKey | UKMJRSIZFCZYLC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|