C19H14F2N2O4 — CID 139769471
5-amino-7-cyclopropyl-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 139769471) has the molecular formula C19H14F2N2O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is 5-amino-7-cyclopropyl-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-7-cyclopropyl-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139769471 |
| Molecular Formula | C19H14F2N2O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 5-amino-7-cyclopropyl-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1c(F)c(C2CC2)c(F)c2c1c(=O)c(C(=O)O)cn2-c1ccc(O)cc1 |
| InChI | InChI=1S/C19H14F2N2O4/c20-14-12(8-1-2-8)15(21)17-13(16(14)22)18(25)11(19(26)27)7-23(17)9-3-5-10(24)6-4-9/h3-8,24H,1-2,22H2,(H,26,27) |
| InChIKey | ONVQTTZLFIAWIV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|