C21H19F2N3O4 — CID 24753374
5-amino-1-cyclopropyl-6,8-difluoro-7-[2-(4-hydroxyphenyl)ethylamino]-4-oxoquinoline-3-carboxylic acid (PubChem CID 24753374) has the molecular formula C21H19F2N3O4 and a molecular weight of 415.40 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6,8-difluoro-7-[2-(4-hydroxyphenyl)ethylamino]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-[2-(4-hydroxyphenyl)ethylamino]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 24753374 |
| Molecular Formula | C21H19F2N3O4 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-[2-(4-hydroxyphenyl)ethylamino]-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1c(F)c(NCCc2ccc(O)cc2)c(F)c2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C21H19F2N3O4/c22-15-17(24)14-19(26(11-3-4-11)9-13(20(14)28)21(29)30)16(23)18(15)25-8-7-10-1-5-12(27)6-2-10/h1-2,5-6,9,11,25,27H,3-4,7-8,24H2,(H,29,30) |
| InChIKey | DVONIJZTCXUNCW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|