C20H20F2N4O — CID 24753286
5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoroquinolin-4-one (PubChem CID 24753286) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is 5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoroquinolin-4-one.
| Compound Name | 5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoroquinolin-4-one |
|---|---|
| PubChem CID | 24753286 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoroquinolin-4-one |
| SMILES | Nc1ccc(CCNc2c(F)c(N)c3c(=O)ccn(C4CC4)c3c2F)cc1 |
| InChI | InChI=1S/C20H20F2N4O/c21-16-18(24)15-14(27)8-10-26(13-5-6-13)20(15)17(22)19(16)25-9-7-11-1-3-12(23)4-2-11/h1-4,8,10,13,25H,5-7,9,23-24H2 |
| InChIKey | DAHLUFYSBVSKLZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|