C24H29N3O2 — CID 163684076
5-amino-1-cyclopropyl-6-ethyl-8-methoxy-7-(3-phenylpropylamino)quinolin-4-one (PubChem CID 163684076) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6-ethyl-8-methoxy-7-(3-phenylpropylamino)quinolin-4-one.
| Compound Name | 5-amino-1-cyclopropyl-6-ethyl-8-methoxy-7-(3-phenylpropylamino)quinolin-4-one |
|---|---|
| PubChem CID | 163684076 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 5-amino-1-cyclopropyl-6-ethyl-8-methoxy-7-(3-phenylpropylamino)quinolin-4-one |
| SMILES | CCc1c(NCCCc2ccccc2)c(OC)c2c(c1N)c(=O)ccn2C1CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-3-18-21(25)20-19(28)13-15-27(17-11-12-17)23(20)24(29-2)22(18)26-14-7-10-16-8-5-4-6-9-16/h4-6,8-9,13,15,17,26H,3,7,10-12,14,25H2,1-2H3 |
| InChIKey | JNHSYVDROABJHO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|