C23H27F2N3O2 — CID 24753940
5-amino-6,8-difluoro-1-(2-phenylethyl)-7-(3-propan-2-yloxypropylamino)quinolin-4-one (PubChem CID 24753940) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is 5-amino-6,8-difluoro-1-(2-phenylethyl)-7-(3-propan-2-yloxypropylamino)quinolin-4-one.
| Compound Name | 5-amino-6,8-difluoro-1-(2-phenylethyl)-7-(3-propan-2-yloxypropylamino)quinolin-4-one |
|---|---|
| PubChem CID | 24753940 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 5-amino-6,8-difluoro-1-(2-phenylethyl)-7-(3-propan-2-yloxypropylamino)quinolin-4-one |
| SMILES | CC(C)OCCCNc1c(F)c(N)c2c(=O)ccn(CCc3ccccc3)c2c1F |
| InChI | InChI=1S/C23H27F2N3O2/c1-15(2)30-14-6-11-27-22-19(24)21(26)18-17(29)10-13-28(23(18)20(22)25)12-9-16-7-4-3-5-8-16/h3-5,7-8,10,13,15,27H,6,9,11-12,14,26H2,1-2H3 |
| InChIKey | IMEJQKHKIPBWQM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|