C22H22ClF2N3O2 — CID 70670420
3-acetyl-5-amino-7-[2-(4-chlorophenyl)ethylamino]-6,8-difluoro-1-propan-2-ylquinolin-4-one (PubChem CID 70670420) has the molecular formula C22H22ClF2N3O2 and a molecular weight of 433.89 g/mol. Its IUPAC name is 3-acetyl-5-amino-7-[2-(4-chlorophenyl)ethylamino]-6,8-difluoro-1-propan-2-ylquinolin-4-one.
| Compound Name | 3-acetyl-5-amino-7-[2-(4-chlorophenyl)ethylamino]-6,8-difluoro-1-propan-2-ylquinolin-4-one |
|---|---|
| PubChem CID | 70670420 |
| Molecular Formula | C22H22ClF2N3O2 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-acetyl-5-amino-7-[2-(4-chlorophenyl)ethylamino]-6,8-difluoro-1-propan-2-ylquinolin-4-one |
| SMILES | CC(=O)c1cn(C(C)C)c2c(F)c(NCCc3ccc(Cl)cc3)c(F)c(N)c2c1=O |
| InChI | InChI=1S/C22H22ClF2N3O2/c1-11(2)28-10-15(12(3)29)22(30)16-19(26)17(24)20(18(25)21(16)28)27-9-8-13-4-6-14(23)7-5-13/h4-7,10-11,27H,8-9,26H2,1-3H3 |
| InChIKey | JJKSCKCSYWPWLC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|