C21H20F2N4O3 — CID 24753108
5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 24753108) has the molecular formula C21H20F2N4O3 and a molecular weight of 414.41 g/mol. Its IUPAC name is 5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 24753108 |
| Molecular Formula | C21H20F2N4O3 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 5-amino-7-[2-(4-aminophenyl)ethylamino]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1ccc(CCNc2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)cc1 |
| InChI | InChI=1S/C21H20F2N4O3/c22-15-17(25)14-19(27(12-5-6-12)9-13(20(14)28)21(29)30)16(23)18(15)26-8-7-10-1-3-11(24)4-2-10/h1-4,9,12,26H,5-8,24-25H2,(H,29,30) |
| InChIKey | DNBUELKLGZXIMW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|