C16H23N5O2 — CID 22370212
N-butan-2-yl-4-(2-methylphenyl)-5-oxo-N-propyltetrazole-1-carboxamide (PubChem CID 22370212) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-butan-2-yl-4-(2-methylphenyl)-5-oxo-N-propyltetrazole-1-carboxamide.
| Compound Name | N-butan-2-yl-4-(2-methylphenyl)-5-oxo-N-propyltetrazole-1-carboxamide |
|---|---|
| PubChem CID | 22370212 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-butan-2-yl-4-(2-methylphenyl)-5-oxo-N-propyltetrazole-1-carboxamide |
| SMILES | CCCN(C(=O)n1nnn(-c2ccccc2C)c1=O)C(C)CC |
| InChI | InChI=1S/C16H23N5O2/c1-5-11-19(13(4)6-2)15(22)21-16(23)20(17-18-21)14-10-8-7-9-12(14)3/h7-10,13H,5-6,11H2,1-4H3 |
| InChIKey | BLCYINUYQYZAIM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|