C25H27N3O3 — CID 22371660
[6-[2-(dimethylamino)ethylamino]-7-oxoindeno[2,1-c]quinolin-3-yl] 2,2-dimethylpropanoate (PubChem CID 22371660) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is [6-[2-(dimethylamino)ethylamino]-7-oxoindeno[2,1-c]quinolin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-[2-(dimethylamino)ethylamino]-7-oxoindeno[2,1-c]quinolin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22371660 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [6-[2-(dimethylamino)ethylamino]-7-oxoindeno[2,1-c]quinolin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CN(C)CCNc1nc2cc(OC(=O)C(C)(C)C)ccc2c2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H27N3O3/c1-25(2,3)24(30)31-15-10-11-18-19(14-15)27-23(26-12-13-28(4)5)21-20(18)16-8-6-7-9-17(16)22(21)29/h6-11,14H,12-13H2,1-5H3,(H,26,27) |
| InChIKey | OUHLVGLNKWCDQO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|