C22H21N3O2 — CID 135939808
3-hydroxy-6-(2-pyrrolidin-1-ylethylamino)indeno[2,1-c]quinolin-7-one (PubChem CID 135939808) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-hydroxy-6-(2-pyrrolidin-1-ylethylamino)indeno[2,1-c]quinolin-7-one.
| Compound Name | 3-hydroxy-6-(2-pyrrolidin-1-ylethylamino)indeno[2,1-c]quinolin-7-one |
|---|---|
| PubChem CID | 135939808 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-hydroxy-6-(2-pyrrolidin-1-ylethylamino)indeno[2,1-c]quinolin-7-one |
| SMILES | O=C1c2ccccc2-c2c1c(NCCN1CCCC1)nc1cc(O)ccc21 |
| InChI | InChI=1S/C22H21N3O2/c26-14-7-8-17-18(13-14)24-22(23-9-12-25-10-3-4-11-25)20-19(17)15-5-1-2-6-16(15)21(20)27/h1-2,5-8,13,26H,3-4,9-12H2,(H,23,24) |
| InChIKey | ARONIKCBFKOXAG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |