C21H24Cl2N2O2 — CID 22376328
1-[4-benzyl-2-(2,4-dichlorophenoxy)piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 22376328) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 1-[4-benzyl-2-(2,4-dichlorophenoxy)piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-benzyl-2-(2,4-dichlorophenoxy)piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 22376328 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[4-benzyl-2-(2,4-dichlorophenoxy)piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(Cc2ccccc2)CC1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-15(2)21(26)25-11-10-24(13-16-6-4-3-5-7-16)14-20(25)27-19-9-8-17(22)12-18(19)23/h3-9,12,15,20H,10-11,13-14H2,1-2H3 |
| InChIKey | VKSZWSFPIKZGJQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |