About 5-(4-bromophenoxy)pentyl thiocyanate
5-(4-bromophenoxy)pentyl thiocyanate (PubChem CID 2238064) has the molecular formula C12H14BrNOS
and a molecular weight of 300.22 g/mol. Its IUPAC name is 5-(4-bromophenoxy)pentyl thiocyanate.
Molecular Properties
| Compound Name | 5-(4-bromophenoxy)pentyl thiocyanate |
| PubChem CID | 2238064 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 5-(4-bromophenoxy)pentyl thiocyanate |
| SMILES | N#CSCCCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H14BrNOS/c13-11-4-6-12(7-5-11)15-8-2-1-3-9-16-10-14/h4-7H,1-3,8-9H2 |
| InChIKey | CCMQXMXTWRMJLD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromophenoxy)pentyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenoxy)pentyl thiocyanate?
The IUPAC name of 5-(4-bromophenoxy)pentyl thiocyanate (CID 2238064) is 5-(4-bromophenoxy)pentyl thiocyanate.
What is the SMILES notation for 5-(4-bromophenoxy)pentyl thiocyanate?
The canonical SMILES for 5-(4-bromophenoxy)pentyl thiocyanate is N#CSCCCCCOc1ccc(Br)cc1.
What is the InChIKey of 5-(4-bromophenoxy)pentyl thiocyanate?
The InChIKey is CCMQXMXTWRMJLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNOS/c13-11-4-6-12(7-5-11)15-8-2-1-3-9-16-10-14/h4-7H,1-3,8-9H2.
What are the key properties of 5-(4-bromophenoxy)pentyl thiocyanate?
5-(4-bromophenoxy)pentyl thiocyanate has a molecular weight of 300.22 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenoxy)pentyl thiocyanate is sourced from PubChem (CID 2238064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).