About 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol
1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol (PubChem CID 22385455) has the molecular formula C24H24O3
and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol.
Molecular Properties
| Compound Name | 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol |
| PubChem CID | 22385455 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol |
| SMILES | C=Cc1cccc(OCC)c1Oc1ccccc1.C=Cc1ccccc1O |
| InChI | InChI=1S/C16H16O2.C8H8O/c1-3-13-9-8-12-15(17-4-2)16(13)18-14-10-6-5-7-11-14;1-2-7-5-3-4-6-8(7)9/h3,5-12H,1,4H2,2H3;2-6,9H,1H2 |
| InChIKey | LVQFVLVCBBPZDS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol?
The IUPAC name of 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol (CID 22385455) is 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol.
What is the SMILES notation for 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol?
The canonical SMILES for 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol is C=Cc1cccc(OCC)c1Oc1ccccc1.C=Cc1ccccc1O.
What is the InChIKey of 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol?
The InChIKey is LVQFVLVCBBPZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2.C8H8O/c1-3-13-9-8-12-15(17-4-2)16(13)18-14-10-6-5-7-11-14;1-2-7-5-3-4-6-8(7)9/h3,5-12H,1,4H2,2H3;2-6,9H,1H2.
What are the key properties of 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol?
1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol has a molecular weight of 360.45 g/mol, XLogP of 6.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-ethoxy-2-phenoxybenzene;2-ethenylphenol is sourced from PubChem (CID 22385455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).