C13H17N4O2- — CID 22388703
imino(dioxido)azanium;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole (PubChem CID 22388703) has the molecular formula C13H17N4O2- and a molecular weight of 261.30 g/mol. Its IUPAC name is imino(dioxido)azanium;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole.
| Compound Name | imino(dioxido)azanium;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 22388703 |
| Molecular Formula | C13H17N4O2- |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | imino(dioxido)azanium;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
| SMILES | [H]N=[N+]([O-])[O-].c1ccc2c(c1)CCCC2C1=NCCN1 |
| InChI | InChI=1S/C13H16N2.HN2O2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13;1-2(3)4/h1-2,4,6,12H,3,5,7-9H2,(H,14,15);(H-,1,3,4)/q;-1 |
| InChIKey | AKWQEHDAWGPXQZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|