C32H31NO6 — CID 22399382
2-[4-hydroxy-1-(naphthalene-1-carbonyl)piperidin-4-yl]-2,2-bis(2-methylphenoxy)acetic acid (PubChem CID 22399382) has the molecular formula C32H31NO6 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[4-hydroxy-1-(naphthalene-1-carbonyl)piperidin-4-yl]-2,2-bis(2-methylphenoxy)acetic acid.
| Compound Name | 2-[4-hydroxy-1-(naphthalene-1-carbonyl)piperidin-4-yl]-2,2-bis(2-methylphenoxy)acetic acid |
|---|---|
| PubChem CID | 22399382 |
| Molecular Formula | C32H31NO6 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 2-[4-hydroxy-1-(naphthalene-1-carbonyl)piperidin-4-yl]-2,2-bis(2-methylphenoxy)acetic acid |
| SMILES | Cc1ccccc1OC(Oc1ccccc1C)(C(=O)O)C1(O)CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C32H31NO6/c1-22-10-3-7-16-27(22)38-32(30(35)36,39-28-17-8-4-11-23(28)2)31(37)18-20-33(21-19-31)29(34)26-15-9-13-24-12-5-6-14-25(24)26/h3-17,37H,18-21H2,1-2H3,(H,35,36) |
| InChIKey | BIFYZCFOMPPHCE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|