C18H14BrN5O3S — CID 2240124
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 2240124) has the molecular formula C18H14BrN5O3S and a molecular weight of 460.31 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 2240124 |
| Molecular Formula | C18H14BrN5O3S |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | Cc1sc2ncn(CC(=O)/N=N/c3c(O)[nH]c4ccc(Br)cc34)c(=O)c2c1C |
| InChI | InChI=1S/C18H14BrN5O3S/c1-8-9(2)28-17-14(8)18(27)24(7-20-17)6-13(25)22-23-15-11-5-10(19)3-4-12(11)21-16(15)26/h3-5,7,21,26H,6H2,1-2H3/b23-22+ |
| InChIKey | RJTCGWLNCRJUJF-GHVJWSGMSA-N |
| XLogP | 4.33 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|