C22H15N5O3S — CID 1193632
N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 1193632) has the molecular formula C22H15N5O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 1193632 |
| Molecular Formula | C22H15N5O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2sc(-c3ccccc3)cc2c1=O)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H15N5O3S/c28-18(25-26-19-14-8-4-5-9-16(14)24-20(19)29)11-27-12-23-21-15(22(27)30)10-17(31-21)13-6-2-1-3-7-13/h1-10,12,24,29H,11H2/b26-25+ |
| InChIKey | YQAMLLXXLSLRDV-OCEACIFDSA-N |
| XLogP | 4.62 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|