C25H20ClN3O4 — CID 22401332
4-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]benzoic acid (PubChem CID 22401332) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is 4-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]benzoic acid.
| Compound Name | 4-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 22401332 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]benzoic acid |
| SMILES | Cn1c(CNC(=O)Nc2ccc(C(=O)O)cc2)c(-c2ccccc2)c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C25H20ClN3O4/c1-29-21(14-27-25(33)28-18-10-7-16(8-11-18)24(31)32)22(15-5-3-2-4-6-15)20-13-17(26)9-12-19(20)23(29)30/h2-13H,14H2,1H3,(H,31,32)(H2,27,28,33) |
| InChIKey | COJOLBNTLSYUEZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |