C21H20ClN3O4 — CID 22401318
methyl 2-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]acetate (PubChem CID 22401318) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is methyl 2-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]acetate.
| Compound Name | methyl 2-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 22401318 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | methyl 2-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methylcarbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)NCc1c(-c2ccccc2)c2cc(Cl)ccc2c(=O)n1C |
| InChI | InChI=1S/C21H20ClN3O4/c1-25-17(11-23-21(28)24-12-18(26)29-2)19(13-6-4-3-5-7-13)16-10-14(22)8-9-15(16)20(25)27/h3-10H,11-12H2,1-2H3,(H2,23,24,28) |
| InChIKey | IIHNFSHRBCLJLJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |