C28H29ClN4O2 — CID 139653196
1-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methyl]-3-[3-[2-(ethylamino)ethyl]phenyl]urea (PubChem CID 139653196) has the molecular formula C28H29ClN4O2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 1-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methyl]-3-[3-[2-(ethylamino)ethyl]phenyl]urea.
| Compound Name | 1-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methyl]-3-[3-[2-(ethylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 139653196 |
| Molecular Formula | C28H29ClN4O2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 1-[(6-chloro-2-methyl-1-oxo-4-phenylisoquinolin-3-yl)methyl]-3-[3-[2-(ethylamino)ethyl]phenyl]urea |
| SMILES | CCNCCc1cccc(NC(=O)NCc2c(-c3ccccc3)c3cc(Cl)ccc3c(=O)n2C)c1 |
| InChI | InChI=1S/C28H29ClN4O2/c1-3-30-15-14-19-8-7-11-22(16-19)32-28(35)31-18-25-26(20-9-5-4-6-10-20)24-17-21(29)12-13-23(24)27(34)33(25)2/h4-13,16-17,30H,3,14-15,18H2,1-2H3,(H2,31,32,35) |
| InChIKey | QPQIYMPDGTYWHQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|