C25H18ClNO4 — CID 2240303
[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 2240303) has the molecular formula C25H18ClNO4 and a molecular weight of 431.88 g/mol. Its IUPAC name is [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2240303 |
| Molecular Formula | C25H18ClNO4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Oc1ccc(CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H18ClNO4/c26-19-10-5-17(6-11-19)9-14-23(28)31-20-12-7-18(8-13-20)15-16-27-24(29)21-3-1-2-4-22(21)25(27)30/h1-14H,15-16H2/b14-9+ |
| InChIKey | VQPSQXNAOXTWCA-NTEUORMPSA-N |
| XLogP | 4.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|