C25H30N2O3S — CID 22403097
1-benzyl-2-[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]piperidine (PubChem CID 22403097) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is 1-benzyl-2-[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]piperidine.
| Compound Name | 1-benzyl-2-[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]piperidine |
|---|---|
| PubChem CID | 22403097 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-benzyl-2-[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]piperidine |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(-c2ccc(C3CCCCN3Cc3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C25H30N2O3S/c1-3-31(28,29)20-12-15-25(30-2)21(17-20)22-13-14-23(26-22)24-11-7-8-16-27(24)18-19-9-5-4-6-10-19/h4-6,9-10,12-15,17,24,26H,3,7-8,11,16,18H2,1-2H3 |
| InChIKey | GJZCKQHKGDTGOQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |