C21H31ClN2O3S — CID 22403144
1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]azocane;hydrochloride (PubChem CID 22403144) has the molecular formula C21H31ClN2O3S and a molecular weight of 427.01 g/mol. Its IUPAC name is 1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]azocane;hydrochloride.
| Compound Name | 1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]azocane;hydrochloride |
|---|---|
| PubChem CID | 22403144 |
| Molecular Formula | C21H31ClN2O3S |
| Molecular Weight | 427.01 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]azocane;hydrochloride |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(-c2ccc(CN3CCCCCCC3)[nH]2)c1.Cl |
| InChI | InChI=1S/C21H30N2O3S.ClH/c1-3-27(24,25)18-10-12-21(26-2)19(15-18)20-11-9-17(22-20)16-23-13-7-5-4-6-8-14-23;/h9-12,15,22H,3-8,13-14,16H2,1-2H3;1H |
| InChIKey | WAJAQJWNPBUREA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |