C23H33ClN2O3S — CID 22861501
(1R,4aR)-1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;hydrochloride (PubChem CID 22861501) has the molecular formula C23H33ClN2O3S and a molecular weight of 453.05 g/mol. Its IUPAC name is (1R,4aR)-1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;hydrochloride.
| Compound Name | (1R,4aR)-1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 22861501 |
| Molecular Formula | C23H33ClN2O3S |
| Molecular Weight | 453.05 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (1R,4aR)-1-[[5-(5-ethylsulfonyl-2-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;hydrochloride |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(-c2ccc(C[C@H]3NCC[C@H]4CCCCC43)[nH]2)c1.Cl |
| InChI | InChI=1S/C23H32N2O3S.ClH/c1-3-29(26,27)18-9-11-23(28-2)20(15-18)21-10-8-17(25-21)14-22-19-7-5-4-6-16(19)12-13-24-22;/h8-11,15-16,19,22,24-25H,3-7,12-14H2,1-2H3;1H/t16-,19?,22-;/m1./s1 |
| InChIKey | KSTABALAGFIECC-KCGVNFTDSA-N |
| XLogP | 4.62 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.05 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |