C35H41N3O7S — CID 67760655
N-benzyl-N-ethyl-4-methoxy-3-[5-[[(2S)-2-phenylazepan-1-yl]methyl]-1H-pyrrol-2-yl]benzenesulfonamide;oxalic acid (PubChem CID 67760655) has the molecular formula C35H41N3O7S and a molecular weight of 647.79 g/mol. Its IUPAC name is N-benzyl-N-ethyl-4-methoxy-3-[5-[[(2S)-2-phenylazepan-1-yl]methyl]-1H-pyrrol-2-yl]benzenesulfonamide;oxalic acid.
| Compound Name | N-benzyl-N-ethyl-4-methoxy-3-[5-[[(2S)-2-phenylazepan-1-yl]methyl]-1H-pyrrol-2-yl]benzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 67760655 |
| Molecular Formula | C35H41N3O7S |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | N-benzyl-N-ethyl-4-methoxy-3-[5-[[(2S)-2-phenylazepan-1-yl]methyl]-1H-pyrrol-2-yl]benzenesulfonamide;oxalic acid |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(OC)c(-c2ccc(CN3CCCCC[C@H]3c3ccccc3)[nH]2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C33H39N3O3S.C2H2O4/c1-3-36(24-26-13-7-4-8-14-26)40(37,38)29-19-21-33(39-2)30(23-29)31-20-18-28(34-31)25-35-22-12-6-11-17-32(35)27-15-9-5-10-16-27;3-1(4)2(5)6/h4-5,7-10,13-16,18-21,23,32,34H,3,6,11-12,17,22,24-25H2,1-2H3;(H,3,4)(H,5,6)/t32-;/m0./s1 |
| InChIKey | FPLQKYKPWFYUEV-UCRKPPETSA-N |
| XLogP | 6.17 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|