C25H30N2O8S — CID 67619008
1-[[5-[5-(benzenesulfonyl)-2-methoxyphenyl]-1H-pyrrol-2-yl]methyl]piperidine;oxalic acid;hydrate (PubChem CID 67619008) has the molecular formula C25H30N2O8S and a molecular weight of 518.59 g/mol. Its IUPAC name is 1-[[5-[5-(benzenesulfonyl)-2-methoxyphenyl]-1H-pyrrol-2-yl]methyl]piperidine;oxalic acid;hydrate.
| Compound Name | 1-[[5-[5-(benzenesulfonyl)-2-methoxyphenyl]-1H-pyrrol-2-yl]methyl]piperidine;oxalic acid;hydrate |
|---|---|
| PubChem CID | 67619008 |
| Molecular Formula | C25H30N2O8S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 1-[[5-[5-(benzenesulfonyl)-2-methoxyphenyl]-1H-pyrrol-2-yl]methyl]piperidine;oxalic acid;hydrate |
| SMILES | COc1ccc(S(=O)(=O)c2ccccc2)cc1-c1ccc(CN2CCCCC2)[nH]1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H26N2O3S.C2H2O4.H2O/c1-28-23-13-11-20(29(26,27)19-8-4-2-5-9-19)16-21(23)22-12-10-18(24-22)17-25-14-6-3-7-15-25;3-1(4)2(5)6;/h2,4-5,8-13,16,24H,3,6-7,14-15,17H2,1H3;(H,3,4)(H,5,6);1H2 |
| InChIKey | WBKVAYYDJYZVNE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|