About (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate
(4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 2240580) has the molecular formula C16H12ClNO4
and a molecular weight of 317.73 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate |
| PubChem CID | 2240580 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClNO4/c17-14-7-4-13(5-8-14)11-22-16(19)9-6-12-2-1-3-15(10-12)18(20)21/h1-10H,11H2/b9-6+ |
| InChIKey | ZJYBCRLLXIVOPE-RMKNXTFCSA-N |
| XLogP | 4.00 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate?
The IUPAC name of (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate (CID 2240580) is (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate.
What is the SMILES notation for (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate?
The canonical SMILES for (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate is O=C(/C=C/c1cccc([N+](=O)[O-])c1)OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate?
The InChIKey is ZJYBCRLLXIVOPE-RMKNXTFCSA-N. The full InChI is InChI=1S/C16H12ClNO4/c17-14-7-4-13(5-8-14)11-22-16(19)9-6-12-2-1-3-15(10-12)18(20)21/h1-10H,11H2/b9-6+.
What are the key properties of (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate?
(4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate has a molecular weight of 317.73 g/mol, XLogP of 4.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 2240580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).