C19H14N2O4S — CID 6212005
(2-phenyl-1,3-thiazol-5-yl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 6212005) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | (2-phenyl-1,3-thiazol-5-yl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6212005 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl)methyl (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)OCc1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H14N2O4S/c22-18(10-9-14-5-4-8-16(11-14)21(23)24)25-13-17-12-20-19(26-17)15-6-2-1-3-7-15/h1-12H,13H2/b10-9+ |
| InChIKey | XZABRSNZDBBJTK-MDZDMXLPSA-N |
| XLogP | 4.47 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|