C26H25N5O3 — CID 22410110
N-[1-[2-(dimethylamino)ethyl]-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]acetamide (PubChem CID 22410110) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]acetamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]acetamide |
|---|---|
| PubChem CID | 22410110 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)cn(CCN(C)C)c2c1 |
| InChI | InChI=1S/C26H25N5O3/c1-15(32)28-16-8-9-18-20(14-31(22(18)12-16)11-10-30(2)3)24-23(25(33)29-26(24)34)19-13-27-21-7-5-4-6-17(19)21/h4-9,12-14,27H,10-11H2,1-3H3,(H,28,32)(H,29,33,34) |
| InChIKey | MEQLPQYZFGRCPN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|