C33H40N4 — CID 22412025
1-benzhydryl-4-[1-[2-(4-tert-butylphenyl)-5-methyl-1H-imidazol-4-yl]ethyl]piperazine (PubChem CID 22412025) has the molecular formula C33H40N4 and a molecular weight of 492.71 g/mol. Its IUPAC name is 1-benzhydryl-4-[1-[2-(4-tert-butylphenyl)-5-methyl-1H-imidazol-4-yl]ethyl]piperazine.
| Compound Name | 1-benzhydryl-4-[1-[2-(4-tert-butylphenyl)-5-methyl-1H-imidazol-4-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 22412025 |
| Molecular Formula | C33H40N4 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 1-benzhydryl-4-[1-[2-(4-tert-butylphenyl)-5-methyl-1H-imidazol-4-yl]ethyl]piperazine |
| SMILES | Cc1[nH]c(-c2ccc(C(C)(C)C)cc2)nc1C(C)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H40N4/c1-24-30(35-32(34-24)28-16-18-29(19-17-28)33(3,4)5)25(2)36-20-22-37(23-21-36)31(26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-19,25,31H,20-23H2,1-5H3,(H,34,35) |
| InChIKey | LHDFFZJVJPUYQB-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |