C29H32N4 — CID 10049076
1-[[2-(2,6-dideuterio-4-methylphenyl)-5-methyl-1H-imidazol-4-yl]methyl]-4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]piperazine (PubChem CID 10049076) has the molecular formula C29H32N4 and a molecular weight of 443.65 g/mol. Its IUPAC name is 1-[[2-(2,6-dideuterio-4-methylphenyl)-5-methyl-1H-imidazol-4-yl]methyl]-4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]piperazine.
| Compound Name | 1-[[2-(2,6-dideuterio-4-methylphenyl)-5-methyl-1H-imidazol-4-yl]methyl]-4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]piperazine |
|---|---|
| PubChem CID | 10049076 |
| Molecular Formula | C29H32N4 |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 1-[[2-(2,6-dideuterio-4-methylphenyl)-5-methyl-1H-imidazol-4-yl]methyl]-4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]piperazine |
| SMILES | [2H]c1cc(C)cc([2H])c1-c1nc(CN2CCN(C(c3ccccc3)c3c([2H])c([2H])c([2H])c([2H])c3[2H])CC2)c(C)[nH]1 |
| InChI | InChI=1S/C29H32N4/c1-22-13-15-26(16-14-22)29-30-23(2)27(31-29)21-32-17-19-33(20-18-32)28(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-16,28H,17-21H2,1-2H3,(H,30,31)/i3D,5D,6D,9D,10D,15D,16D |
| InChIKey | HTDFEXRUDGWNHA-TXIMJBTBSA-N |
| XLogP | 5.60 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |