C29H33ClN4 — CID 67849511
1-benzhydryl-4-[[5-methyl-1-(4-methylphenyl)imidazol-4-yl]methyl]piperazine;hydrochloride (PubChem CID 67849511) has the molecular formula C29H33ClN4 and a molecular weight of 473.06 g/mol. Its IUPAC name is 1-benzhydryl-4-[[5-methyl-1-(4-methylphenyl)imidazol-4-yl]methyl]piperazine;hydrochloride.
| Compound Name | 1-benzhydryl-4-[[5-methyl-1-(4-methylphenyl)imidazol-4-yl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 67849511 |
| Molecular Formula | C29H33ClN4 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-benzhydryl-4-[[5-methyl-1-(4-methylphenyl)imidazol-4-yl]methyl]piperazine;hydrochloride |
| SMILES | Cc1ccc(-n2cnc(CN3CCN(C(c4ccccc4)c4ccccc4)CC3)c2C)cc1.Cl |
| InChI | InChI=1S/C29H32N4.ClH/c1-23-13-15-27(16-14-23)33-22-30-28(24(33)2)21-31-17-19-32(20-18-31)29(25-9-5-3-6-10-25)26-11-7-4-8-12-26;/h3-16,22,29H,17-21H2,1-2H3;1H |
| InChIKey | YHACZHSOYSIZSJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |