C28H30N4 — CID 19106667
1-benzhydryl-4-[[2-(4-methylphenyl)-1H-imidazol-5-yl]methyl]piperazine (PubChem CID 19106667) has the molecular formula C28H30N4 and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-benzhydryl-4-[[2-(4-methylphenyl)-1H-imidazol-5-yl]methyl]piperazine.
| Compound Name | 1-benzhydryl-4-[[2-(4-methylphenyl)-1H-imidazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 19106667 |
| Molecular Formula | C28H30N4 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-benzhydryl-4-[[2-(4-methylphenyl)-1H-imidazol-5-yl]methyl]piperazine |
| SMILES | Cc1ccc(-c2ncc(CN3CCN(C(c4ccccc4)c4ccccc4)CC3)[nH]2)cc1 |
| InChI | InChI=1S/C28H30N4/c1-22-12-14-25(15-13-22)28-29-20-26(30-28)21-31-16-18-32(19-17-31)27(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,20,27H,16-19,21H2,1H3,(H,29,30) |
| InChIKey | WOLVBHVJURJLFT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |