C19H42N2O — CID 22412585
N'-(1-tridecoxypropyl)propane-1,3-diamine (PubChem CID 22412585) has the molecular formula C19H42N2O and a molecular weight of 314.56 g/mol. Its IUPAC name is N'-(1-tridecoxypropyl)propane-1,3-diamine.
| Compound Name | N'-(1-tridecoxypropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 22412585 |
| Molecular Formula | C19H42N2O |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.33 |
| IUPAC Name | N'-(1-tridecoxypropyl)propane-1,3-diamine |
| SMILES | CCCCCCCCCCCCCOC(CC)NCCCN |
| InChI | InChI=1S/C19H42N2O/c1-3-5-6-7-8-9-10-11-12-13-14-18-22-19(4-2)21-17-15-16-20/h19,21H,3-18,20H2,1-2H3 |
| InChIKey | JEOJNZOIXJUREZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|