C16H39NO5Si4 — CID 22412624
prop-2-enyl N-propyl-N-tris(trimethylsilyloxy)silylcarbamate (PubChem CID 22412624) has the molecular formula C16H39NO5Si4 and a molecular weight of 437.83 g/mol. Its IUPAC name is prop-2-enyl N-propyl-N-tris(trimethylsilyloxy)silylcarbamate.
| Compound Name | prop-2-enyl N-propyl-N-tris(trimethylsilyloxy)silylcarbamate |
|---|---|
| PubChem CID | 22412624 |
| Molecular Formula | C16H39NO5Si4 |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | prop-2-enyl N-propyl-N-tris(trimethylsilyloxy)silylcarbamate |
| SMILES | C=CCOC(=O)N(CCC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H39NO5Si4/c1-12-14-17(16(18)19-15-13-2)26(20-23(3,4)5,21-24(6,7)8)22-25(9,10)11/h13H,2,12,14-15H2,1,3-11H3 |
| InChIKey | FLFCXCFZHMBCEF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|