C13H25NO7Si — CID 88513136
(E)-2-[propyl(triethoxysilyl)amino]but-2-enedioic acid (PubChem CID 88513136) has the molecular formula C13H25NO7Si and a molecular weight of 335.43 g/mol. Its IUPAC name is (E)-2-[propyl(triethoxysilyl)amino]but-2-enedioic acid.
| Compound Name | (E)-2-[propyl(triethoxysilyl)amino]but-2-enedioic acid |
|---|---|
| PubChem CID | 88513136 |
| Molecular Formula | C13H25NO7Si |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (E)-2-[propyl(triethoxysilyl)amino]but-2-enedioic acid |
| SMILES | CCCN(/C(=C/C(=O)O)C(=O)O)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H25NO7Si/c1-5-9-14(11(13(17)18)10-12(15)16)22(19-6-2,20-7-3)21-8-4/h10H,5-9H2,1-4H3,(H,15,16)(H,17,18)/b11-10+ |
| InChIKey | JGMVIYYNQKYKDS-ZHACJKMWSA-N |
| XLogP | 1.30 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|