About butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate
butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate (PubChem CID 22414319) has the molecular formula C8H13NO2S2
and a molecular weight of 219.33 g/mol. Its IUPAC name is butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate.
Molecular Properties
| Compound Name | butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate |
| PubChem CID | 22414319 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(=S)N1 |
| InChI | InChI=1S/C8H13NO2S2/c1-2-3-4-11-7(10)6-5-13-8(12)9-6/h6H,2-5H2,1H3,(H,9,12) |
| InChIKey | NHTMJYKIVIJWLX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate?
The IUPAC name of butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate (CID 22414319) is butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate is CCCCOC(=O)C1CSC(=S)N1.
What is the InChIKey of butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate?
The InChIKey is NHTMJYKIVIJWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S2/c1-2-3-4-11-7(10)6-5-13-8(12)9-6/h6H,2-5H2,1H3,(H,9,12).
What are the key properties of butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate?
butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate has a molecular weight of 219.33 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-sulfanylidene-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 22414319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).