C27H51ClN2O3S — CID 22416084
5-(2-chloroanilino)pentane-1-sulfonate;tetrabutylazanium (PubChem CID 22416084) has the molecular formula C27H51ClN2O3S and a molecular weight of 519.24 g/mol. Its IUPAC name is 5-(2-chloroanilino)pentane-1-sulfonate;tetrabutylazanium.
| Compound Name | 5-(2-chloroanilino)pentane-1-sulfonate;tetrabutylazanium |
|---|---|
| PubChem CID | 22416084 |
| Molecular Formula | C27H51ClN2O3S |
| Molecular Weight | 519.24 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | 5-(2-chloroanilino)pentane-1-sulfonate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])CCCCCNc1ccccc1Cl |
| InChI | InChI=1S/C16H36N.C11H16ClNO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;12-10-6-2-3-7-11(10)13-8-4-1-5-9-17(14,15)16/h5-16H2,1-4H3;2-3,6-7,13H,1,4-5,8-9H2,(H,14,15,16)/q+1;/p-1 |
| InChIKey | GBTIFZLFYKFYKM-UHFFFAOYSA-M |
| XLogP | 7.47 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.24 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|