C14H9Cl4F4NS — CID 22418328
3-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole (PubChem CID 22418328) has the molecular formula C14H9Cl4F4NS and a molecular weight of 441.10 g/mol. Its IUPAC name is 3-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole.
| Compound Name | 3-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 22418328 |
| Molecular Formula | C14H9Cl4F4NS |
| Molecular Weight | 441.10 g/mol |
| Exact Mass | 438.91 |
| IUPAC Name | 3-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole |
| SMILES | Cc1cc(SC(F)(Cl)Cl)c(C)n1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H9Cl4F4NS/c1-6-3-11(24-14(17,18)22)7(2)23(6)12-9(15)4-8(5-10(12)16)13(19,20)21/h3-5H,1-2H3 |
| InChIKey | RQUCDAPDCWFLQY-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.10 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|