C14H12Cl2F3NO — CID 170871674
[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]methanol (PubChem CID 170871674) has the molecular formula C14H12Cl2F3NO and a molecular weight of 338.16 g/mol. Its IUPAC name is [1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]methanol.
| Compound Name | [1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 170871674 |
| Molecular Formula | C14H12Cl2F3NO |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | [1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]methanol |
| SMILES | Cc1cc(CO)c(C)n1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H12Cl2F3NO/c1-7-3-9(6-21)8(2)20(7)13-11(15)4-10(5-12(13)16)14(17,18)19/h3-5,21H,6H2,1-2H3 |
| InChIKey | FHULZRZLWFQBFL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|