C28H28N2O5 — CID 22419125
2-[4-[[2-butyl-6-(2-hydroxyethyl)-5-methyl-4,7-dioxobenzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 22419125) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-[4-[[2-butyl-6-(2-hydroxyethyl)-5-methyl-4,7-dioxobenzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-butyl-6-(2-hydroxyethyl)-5-methyl-4,7-dioxobenzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 22419125 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[4-[[2-butyl-6-(2-hydroxyethyl)-5-methyl-4,7-dioxobenzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc2c(n1Cc1ccc(-c3ccccc3C(=O)O)cc1)C(=O)C(CCO)=C(C)C2=O |
| InChI | InChI=1S/C28H28N2O5/c1-3-4-9-23-29-24-25(27(33)20(14-15-31)17(2)26(24)32)30(23)16-18-10-12-19(13-11-18)21-7-5-6-8-22(21)28(34)35/h5-8,10-13,31H,3-4,9,14-16H2,1-2H3,(H,34,35) |
| InChIKey | LJLMVPCKZCBEIR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|