About 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride
4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride (PubChem CID 22419200) has the molecular formula C8H15Cl3N2O2S
and a molecular weight of 309.65 g/mol. Its IUPAC name is 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride |
| PubChem CID | 22419200 |
| Molecular Formula | C8H15Cl3N2O2S |
| Molecular Weight | 309.65 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride |
| SMILES | Cl.Cl.NCCSc1cc(O)c(Cl)cc1N.O |
| InChI | InChI=1S/C8H11ClN2OS.2ClH.H2O/c9-5-3-6(11)8(4-7(5)12)13-2-1-10;;;/h3-4,12H,1-2,10-11H2;2*1H;1H2 |
| InChIKey | UMNVDIINMQMHQD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride?
The IUPAC name of 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride (CID 22419200) is 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride.
What is the SMILES notation for 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride?
The canonical SMILES for 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride is Cl.Cl.NCCSc1cc(O)c(Cl)cc1N.O.
What is the InChIKey of 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride?
The InChIKey is UMNVDIINMQMHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2OS.2ClH.H2O/c9-5-3-6(11)8(4-7(5)12)13-2-1-10;;;/h3-4,12H,1-2,10-11H2;2*1H;1H2.
What are the key properties of 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride?
4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride has a molecular weight of 309.65 g/mol, XLogP of 1.70, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-(2-aminoethylsulfanyl)-2-chlorophenol;hydrate;dihydrochloride is sourced from PubChem (CID 22419200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).