C8H13ClN4O2S — CID 67655371
2-(2-aminoethylsulfanyl)-5-nitrobenzene-1,4-diamine;hydrochloride (PubChem CID 67655371) has the molecular formula C8H13ClN4O2S and a molecular weight of 264.74 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-5-nitrobenzene-1,4-diamine;hydrochloride.
| Compound Name | 2-(2-aminoethylsulfanyl)-5-nitrobenzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 67655371 |
| Molecular Formula | C8H13ClN4O2S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-5-nitrobenzene-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCSc1cc(N)c([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C8H12N4O2S.ClH/c9-1-2-15-8-4-5(10)7(12(13)14)3-6(8)11;/h3-4H,1-2,9-11H2;1H |
| InChIKey | KNJZYLKZBTUADX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|