C11H14N4O3S — CID 22425628
6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 22425628) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 22425628 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(S(=O)(=O)C3CCCCC3)nn12 |
| InChI | InChI=1S/C11H14N4O3S/c16-11-13-12-9-6-7-10(14-15(9)11)19(17,18)8-4-2-1-3-5-8/h6-8H,1-5H2,(H,13,16) |
| InChIKey | PHOALJQQKFIZMV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |