C17H21N3O4 — CID 22427450
5-(3-hydroxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide (PubChem CID 22427450) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(3-hydroxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 22427450 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 5-(3-hydroxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(-c2cccc(O)c2)on1 |
| InChI | InChI=1S/C17H21N3O4/c21-14-4-1-3-13(11-14)16-12-15(19-24-16)17(22)18-5-2-6-20-7-9-23-10-8-20/h1,3-4,11-12,21H,2,5-10H2,(H,18,22) |
| InChIKey | MSBLBAKADLJWQI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|