C11H11FN2S — CID 22428573
4-(3-fluorophenyl)-2,2-dimethyl-1H-imidazole-5-thione (PubChem CID 22428573) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2,2-dimethyl-1H-imidazole-5-thione.
| Compound Name | 4-(3-fluorophenyl)-2,2-dimethyl-1H-imidazole-5-thione |
|---|---|
| PubChem CID | 22428573 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-(3-fluorophenyl)-2,2-dimethyl-1H-imidazole-5-thione |
| SMILES | CC1(C)N=C(c2cccc(F)c2)C(=S)N1 |
| InChI | InChI=1S/C11H11FN2S/c1-11(2)13-9(10(15)14-11)7-4-3-5-8(12)6-7/h3-6H,1-2H3,(H,14,15) |
| InChIKey | PPIPHDSAQBUQHY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|